C20H24BF2N5O3S — CID 123470642
CID 123470642 (PubChem CID 123470642) has the molecular formula C20H24BF2N5O3S and a molecular weight of 463.32 g/mol.
| Compound Name | CID 123470642 |
|---|---|
| PubChem CID | 123470642 |
| Molecular Formula | C20H24BF2N5O3S |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)c(COc2nsc(NC(=O)NCCCCN3CCCC3)c2C(N)=O)c(F)c1 |
| InChI | InChI=1S/C20H24BF2N5O3S/c21-12-9-14(22)13(15(23)10-12)11-31-18-16(17(24)29)19(32-27-18)26-20(30)25-5-1-2-6-28-7-3-4-8-28/h9-10H,1-8,11H2,(H2,24,29)(H2,25,26,30) |
| InChIKey | RNBRVBYTEMQIAU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|