C46H56Br2F4N10O13S2 — CID 10148684
bis(3-[(4-bromo-2,6-difluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide);2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 10148684) has the molecular formula C46H56Br2F4N10O13S2 and a molecular weight of 1256.94 g/mol. Its IUPAC name is bis(3-[(4-bromo-2,6-difluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide);2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | bis(3-[(4-bromo-2,6-difluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide);2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 10148684 |
| Molecular Formula | C46H56Br2F4N10O13S2 |
| Molecular Weight | 1256.94 g/mol |
| Exact Mass | 1254.18 |
| IUPAC Name | bis(3-[(4-bromo-2,6-difluorophenyl)methoxy]-5-(4-pyrrolidin-1-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide);2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | NC(=O)c1c(OCc2c(F)cc(Br)cc2F)nsc1NC(=O)NCCCCN1CCCC1.NC(=O)c1c(OCc2c(F)cc(Br)cc2F)nsc1NC(=O)NCCCCN1CCCC1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/2C20H24BrF2N5O3S.C6H8O7/c2*21-12-9-14(22)13(15(23)10-12)11-31-18-16(17(24)29)19(32-27-18)26-20(30)25-5-1-2-6-28-7-3-4-8-28;7-3(8)1-6(13,5(11)12)2-4(9)10/h2*9-10H,1-8,11H2,(H2,24,29)(H2,25,26,30);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | WWIBGLUDWOJCCF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 351.29 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 77 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1256.94 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|