C17H19ClF2N4O4S — CID 69228022
3-[(4-chloro-2,6-difluorophenyl)methoxy]-5-(5-hydroxypentylcarbamoylamino)-1,2-thiazole-4-carboxamide (PubChem CID 69228022) has the molecular formula C17H19ClF2N4O4S and a molecular weight of 448.88 g/mol. Its IUPAC name is 3-[(4-chloro-2,6-difluorophenyl)methoxy]-5-(5-hydroxypentylcarbamoylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-[(4-chloro-2,6-difluorophenyl)methoxy]-5-(5-hydroxypentylcarbamoylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 69228022 |
| Molecular Formula | C17H19ClF2N4O4S |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 3-[(4-chloro-2,6-difluorophenyl)methoxy]-5-(5-hydroxypentylcarbamoylamino)-1,2-thiazole-4-carboxamide |
| SMILES | NC(=O)c1c(OCc2c(F)cc(Cl)cc2F)nsc1NC(=O)NCCCCCO |
| InChI | InChI=1S/C17H19ClF2N4O4S/c18-9-6-11(19)10(12(20)7-9)8-28-15-13(14(21)26)16(29-24-15)23-17(27)22-4-2-1-3-5-25/h6-7,25H,1-5,8H2,(H2,21,26)(H2,22,23,27) |
| InChIKey | NFMOVPSJJKISNE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|