C19H24ClF2N5O5S — CID 54215356
5-[3-[bis(2-hydroxyethyl)amino]propylcarbamoylamino]-3-[(4-chloro-2,5-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide (PubChem CID 54215356) has the molecular formula C19H24ClF2N5O5S and a molecular weight of 507.95 g/mol. Its IUPAC name is 5-[3-[bis(2-hydroxyethyl)amino]propylcarbamoylamino]-3-[(4-chloro-2,5-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide.
| Compound Name | 5-[3-[bis(2-hydroxyethyl)amino]propylcarbamoylamino]-3-[(4-chloro-2,5-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 54215356 |
| Molecular Formula | C19H24ClF2N5O5S |
| Molecular Weight | 507.95 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 5-[3-[bis(2-hydroxyethyl)amino]propylcarbamoylamino]-3-[(4-chloro-2,5-difluorophenyl)methoxy]-1,2-thiazole-4-carboxamide |
| SMILES | NC(=O)c1c(OCc2cc(F)c(Cl)cc2F)nsc1NC(=O)NCCCN(CCO)CCO |
| InChI | InChI=1S/C19H24ClF2N5O5S/c20-12-9-13(21)11(8-14(12)22)10-32-17-15(16(23)30)18(33-26-17)25-19(31)24-2-1-3-27(4-6-28)5-7-29/h8-9,28-29H,1-7,10H2,(H2,23,30)(H2,24,25,31) |
| InChIKey | PYUDCXWSZMJOPR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 150.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.95 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|