C21H22F2N6O3S — CID 54485579
3-[(2,5-difluoro-4-methylphenyl)methoxy]-5-[3-(pyridin-2-ylamino)propylcarbamoylamino]-1,2-thiazole-4-carboxamide (PubChem CID 54485579) has the molecular formula C21H22F2N6O3S and a molecular weight of 476.51 g/mol. Its IUPAC name is 3-[(2,5-difluoro-4-methylphenyl)methoxy]-5-[3-(pyridin-2-ylamino)propylcarbamoylamino]-1,2-thiazole-4-carboxamide.
| Compound Name | 3-[(2,5-difluoro-4-methylphenyl)methoxy]-5-[3-(pyridin-2-ylamino)propylcarbamoylamino]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 54485579 |
| Molecular Formula | C21H22F2N6O3S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 3-[(2,5-difluoro-4-methylphenyl)methoxy]-5-[3-(pyridin-2-ylamino)propylcarbamoylamino]-1,2-thiazole-4-carboxamide |
| SMILES | Cc1cc(F)c(COc2nsc(NC(=O)NCCCNc3ccccn3)c2C(N)=O)cc1F |
| InChI | InChI=1S/C21H22F2N6O3S/c1-12-9-15(23)13(10-14(12)22)11-32-19-17(18(24)30)20(33-29-19)28-21(31)27-8-4-7-26-16-5-2-3-6-25-16/h2-3,5-6,9-10H,4,7-8,11H2,1H3,(H2,24,30)(H,25,26)(H2,27,28,31) |
| InChIKey | XSBCEOLHBGMCRP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|