C20H26F3N5O5S — CID 54347579
5-[3-[bis(2-hydroxyethyl)amino]propylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide (PubChem CID 54347579) has the molecular formula C20H26F3N5O5S and a molecular weight of 505.52 g/mol. Its IUPAC name is 5-[3-[bis(2-hydroxyethyl)amino]propylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide.
| Compound Name | 5-[3-[bis(2-hydroxyethyl)amino]propylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 54347579 |
| Molecular Formula | C20H26F3N5O5S |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 5-[3-[bis(2-hydroxyethyl)amino]propylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide |
| SMILES | Cc1cc(F)c(COc2nsc(NC(=O)NCCCN(CCO)CCO)c2C(N)=O)c(F)c1F |
| InChI | InChI=1S/C20H26F3N5O5S/c1-11-9-13(21)12(16(23)15(11)22)10-33-18-14(17(24)31)19(34-27-18)26-20(32)25-3-2-4-28(5-7-29)6-8-30/h9,29-30H,2-8,10H2,1H3,(H2,24,31)(H2,25,26,32) |
| InChIKey | UDJJTMQKOBIQDG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 150.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|