C22H29F3N4O4S — CID 87099068
methyl 5-[4-(diethylamino)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylate (PubChem CID 87099068) has the molecular formula C22H29F3N4O4S and a molecular weight of 502.56 g/mol. Its IUPAC name is methyl 5-[4-(diethylamino)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylate.
| Compound Name | methyl 5-[4-(diethylamino)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 87099068 |
| Molecular Formula | C22H29F3N4O4S |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | methyl 5-[4-(diethylamino)butylcarbamoylamino]-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxylate |
| SMILES | CCN(CC)CCCCNC(=O)Nc1snc(OCc2c(F)cc(C)c(F)c2F)c1C(=O)OC |
| InChI | InChI=1S/C22H29F3N4O4S/c1-5-29(6-2)10-8-7-9-26-22(31)27-20-16(21(30)32-4)19(28-34-20)33-12-14-15(23)11-13(3)17(24)18(14)25/h11H,5-10,12H2,1-4H3,(H2,26,27,31) |
| InChIKey | JTLGSPVHFRXHEH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|