C20H25ClF2N4O5S — CID 87099116
[3-[(3-chloro-2,6-difluoro-4-methylphenyl)methoxy]-5-[4-(dimethylamino)butylcarbamoylamino]-1,2-thiazol-4-yl] methyl carbonate (PubChem CID 87099116) has the molecular formula C20H25ClF2N4O5S and a molecular weight of 506.96 g/mol. Its IUPAC name is [3-[(3-chloro-2,6-difluoro-4-methylphenyl)methoxy]-5-[4-(dimethylamino)butylcarbamoylamino]-1,2-thiazol-4-yl] methyl carbonate.
| Compound Name | [3-[(3-chloro-2,6-difluoro-4-methylphenyl)methoxy]-5-[4-(dimethylamino)butylcarbamoylamino]-1,2-thiazol-4-yl] methyl carbonate |
|---|---|
| PubChem CID | 87099116 |
| Molecular Formula | C20H25ClF2N4O5S |
| Molecular Weight | 506.96 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | [3-[(3-chloro-2,6-difluoro-4-methylphenyl)methoxy]-5-[4-(dimethylamino)butylcarbamoylamino]-1,2-thiazol-4-yl] methyl carbonate |
| SMILES | COC(=O)Oc1c(OCc2c(F)cc(C)c(Cl)c2F)nsc1NC(=O)NCCCCN(C)C |
| InChI | InChI=1S/C20H25ClF2N4O5S/c1-11-9-13(22)12(15(23)14(11)21)10-31-17-16(32-20(29)30-4)18(33-26-17)25-19(28)24-7-5-6-8-27(2)3/h9H,5-8,10H2,1-4H3,(H2,24,25,28) |
| InChIKey | GYTIUGQYKPXRKM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.96 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|