C20H26F2N4O4S — CID 18550146
3-[(2,4-difluorophenyl)methoxy]-5-[6-(dimethylamino)hexylcarbamoylamino]-1,2-thiazole-4-carboxylic acid (PubChem CID 18550146) has the molecular formula C20H26F2N4O4S and a molecular weight of 456.52 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methoxy]-5-[6-(dimethylamino)hexylcarbamoylamino]-1,2-thiazole-4-carboxylic acid.
| Compound Name | 3-[(2,4-difluorophenyl)methoxy]-5-[6-(dimethylamino)hexylcarbamoylamino]-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18550146 |
| Molecular Formula | C20H26F2N4O4S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methoxy]-5-[6-(dimethylamino)hexylcarbamoylamino]-1,2-thiazole-4-carboxylic acid |
| SMILES | CN(C)CCCCCCNC(=O)Nc1snc(OCc2ccc(F)cc2F)c1C(=O)O |
| InChI | InChI=1S/C20H26F2N4O4S/c1-26(2)10-6-4-3-5-9-23-20(29)24-18-16(19(27)28)17(25-31-18)30-12-13-7-8-14(21)11-15(13)22/h7-8,11H,3-6,9-10,12H2,1-2H3,(H,27,28)(H2,23,24,29) |
| InChIKey | NACPBKGXEITLIC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|