C25H34F3N5O5S — CID 18550509
5-[7-[4-(2-hydroxyethyl)piperazin-1-yl]heptylcarbamoylamino]-3-[(2,4,5-trifluorophenyl)methoxy]-1,2-thiazole-4-carboxylic acid (PubChem CID 18550509) has the molecular formula C25H34F3N5O5S and a molecular weight of 573.64 g/mol. Its IUPAC name is 5-[7-[4-(2-hydroxyethyl)piperazin-1-yl]heptylcarbamoylamino]-3-[(2,4,5-trifluorophenyl)methoxy]-1,2-thiazole-4-carboxylic acid.
| Compound Name | 5-[7-[4-(2-hydroxyethyl)piperazin-1-yl]heptylcarbamoylamino]-3-[(2,4,5-trifluorophenyl)methoxy]-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18550509 |
| Molecular Formula | C25H34F3N5O5S |
| Molecular Weight | 573.64 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | 5-[7-[4-(2-hydroxyethyl)piperazin-1-yl]heptylcarbamoylamino]-3-[(2,4,5-trifluorophenyl)methoxy]-1,2-thiazole-4-carboxylic acid |
| SMILES | O=C(NCCCCCCCN1CCN(CCO)CC1)Nc1snc(OCc2cc(F)c(F)cc2F)c1C(=O)O |
| InChI | InChI=1S/C25H34F3N5O5S/c26-18-15-20(28)19(27)14-17(18)16-38-22-21(24(35)36)23(39-31-22)30-25(37)29-6-4-2-1-3-5-7-32-8-10-33(11-9-32)12-13-34/h14-15,34H,1-13,16H2,(H,35,36)(H2,29,30,37) |
| InChIKey | BFYZLOZFSYYFSY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|