C20H25FN4O6S — CID 18549827
3-[(2-fluoro-4-methoxyphenyl)methoxy]-5-(3-morpholin-4-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxylic acid (PubChem CID 18549827) has the molecular formula C20H25FN4O6S and a molecular weight of 468.51 g/mol. Its IUPAC name is 3-[(2-fluoro-4-methoxyphenyl)methoxy]-5-(3-morpholin-4-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxylic acid.
| Compound Name | 3-[(2-fluoro-4-methoxyphenyl)methoxy]-5-(3-morpholin-4-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18549827 |
| Molecular Formula | C20H25FN4O6S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 3-[(2-fluoro-4-methoxyphenyl)methoxy]-5-(3-morpholin-4-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxylic acid |
| SMILES | COc1ccc(COc2nsc(NC(=O)NCCCN3CCOCC3)c2C(=O)O)c(F)c1 |
| InChI | InChI=1S/C20H25FN4O6S/c1-29-14-4-3-13(15(21)11-14)12-31-17-16(19(26)27)18(32-24-17)23-20(28)22-5-2-6-25-7-9-30-10-8-25/h3-4,11H,2,5-10,12H2,1H3,(H,26,27)(H2,22,23,28) |
| InChIKey | FRQHCACUNZCLHO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 122.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|