C21H28FN5O5S — CID 54302571
3-[(2-fluoro-4-methoxyphenyl)methoxy]-5-(4-morpholin-4-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide (PubChem CID 54302571) has the molecular formula C21H28FN5O5S and a molecular weight of 481.55 g/mol. Its IUPAC name is 3-[(2-fluoro-4-methoxyphenyl)methoxy]-5-(4-morpholin-4-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-[(2-fluoro-4-methoxyphenyl)methoxy]-5-(4-morpholin-4-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 54302571 |
| Molecular Formula | C21H28FN5O5S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 3-[(2-fluoro-4-methoxyphenyl)methoxy]-5-(4-morpholin-4-ylbutylcarbamoylamino)-1,2-thiazole-4-carboxamide |
| SMILES | COc1ccc(COc2nsc(NC(=O)NCCCCN3CCOCC3)c2C(N)=O)c(F)c1 |
| InChI | InChI=1S/C21H28FN5O5S/c1-30-15-5-4-14(16(22)12-15)13-32-19-17(18(23)28)20(33-26-19)25-21(29)24-6-2-3-7-27-8-10-31-11-9-27/h4-5,12H,2-3,6-11,13H2,1H3,(H2,23,28)(H2,24,25,29) |
| InChIKey | SFGZAVHRLGEKGW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|