C17H22ClN5O4S2 — CID 54386247
3-[(5-chlorothiophen-2-yl)methoxy]-5-(3-morpholin-4-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxamide (PubChem CID 54386247) has the molecular formula C17H22ClN5O4S2 and a molecular weight of 459.98 g/mol. Its IUPAC name is 3-[(5-chlorothiophen-2-yl)methoxy]-5-(3-morpholin-4-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-[(5-chlorothiophen-2-yl)methoxy]-5-(3-morpholin-4-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 54386247 |
| Molecular Formula | C17H22ClN5O4S2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 3-[(5-chlorothiophen-2-yl)methoxy]-5-(3-morpholin-4-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
| SMILES | NC(=O)c1c(OCc2ccc(Cl)s2)nsc1NC(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C17H22ClN5O4S2/c18-12-3-2-11(28-12)10-27-15-13(14(19)24)16(29-22-15)21-17(25)20-4-1-5-23-6-8-26-9-7-23/h2-3H,1,4-10H2,(H2,19,24)(H2,20,21,25) |
| InChIKey | VDLKCQOCOOPCFV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|