C23H30ClF2N5O4S — CID 18550624
3-[(4-chloro-2,5-difluorophenyl)methoxy]-5-[6-(4-methylpiperazin-1-yl)hexylcarbamoylamino]-1,2-thiazole-4-carboxylic acid (PubChem CID 18550624) has the molecular formula C23H30ClF2N5O4S and a molecular weight of 546.04 g/mol. Its IUPAC name is 3-[(4-chloro-2,5-difluorophenyl)methoxy]-5-[6-(4-methylpiperazin-1-yl)hexylcarbamoylamino]-1,2-thiazole-4-carboxylic acid.
| Compound Name | 3-[(4-chloro-2,5-difluorophenyl)methoxy]-5-[6-(4-methylpiperazin-1-yl)hexylcarbamoylamino]-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18550624 |
| Molecular Formula | C23H30ClF2N5O4S |
| Molecular Weight | 546.04 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 3-[(4-chloro-2,5-difluorophenyl)methoxy]-5-[6-(4-methylpiperazin-1-yl)hexylcarbamoylamino]-1,2-thiazole-4-carboxylic acid |
| SMILES | CN1CCN(CCCCCCNC(=O)Nc2snc(OCc3cc(F)c(Cl)cc3F)c2C(=O)O)CC1 |
| InChI | InChI=1S/C23H30ClF2N5O4S/c1-30-8-10-31(11-9-30)7-5-3-2-4-6-27-23(34)28-21-19(22(32)33)20(29-36-21)35-14-15-12-18(26)16(24)13-17(15)25/h12-13H,2-11,14H2,1H3,(H,32,33)(H2,27,28,34) |
| InChIKey | VBZAVGSJOOAQRI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.04 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|