C19H19F3N6O3S — CID 54476126
5-(3-imidazol-1-ylpropylcarbamoylamino)-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide (PubChem CID 54476126) has the molecular formula C19H19F3N6O3S and a molecular weight of 468.46 g/mol. Its IUPAC name is 5-(3-imidazol-1-ylpropylcarbamoylamino)-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide.
| Compound Name | 5-(3-imidazol-1-ylpropylcarbamoylamino)-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 54476126 |
| Molecular Formula | C19H19F3N6O3S |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 5-(3-imidazol-1-ylpropylcarbamoylamino)-3-[(2,3,6-trifluoro-4-methylphenyl)methoxy]-1,2-thiazole-4-carboxamide |
| SMILES | Cc1cc(F)c(COc2nsc(NC(=O)NCCCn3ccnc3)c2C(N)=O)c(F)c1F |
| InChI | InChI=1S/C19H19F3N6O3S/c1-10-7-12(20)11(15(22)14(10)21)8-31-17-13(16(23)29)18(32-27-17)26-19(30)25-3-2-5-28-6-4-24-9-28/h4,6-7,9H,2-3,5,8H2,1H3,(H2,23,29)(H2,25,26,30) |
| InChIKey | XLRWXKLZPDETEZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|