C15H16Cl2N4O4S — CID 54422898
3-[(2,5-dichlorophenyl)methoxy]-5-(3-hydroxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide (PubChem CID 54422898) has the molecular formula C15H16Cl2N4O4S and a molecular weight of 419.29 g/mol. Its IUPAC name is 3-[(2,5-dichlorophenyl)methoxy]-5-(3-hydroxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-[(2,5-dichlorophenyl)methoxy]-5-(3-hydroxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 54422898 |
| Molecular Formula | C15H16Cl2N4O4S |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 3-[(2,5-dichlorophenyl)methoxy]-5-(3-hydroxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
| SMILES | NC(=O)c1c(OCc2cc(Cl)ccc2Cl)nsc1NC(=O)NCCCO |
| InChI | InChI=1S/C15H16Cl2N4O4S/c16-9-2-3-10(17)8(6-9)7-25-13-11(12(18)23)14(26-21-13)20-15(24)19-4-1-5-22/h2-3,6,22H,1,4-5,7H2,(H2,18,23)(H2,19,20,24) |
| InChIKey | WCARHBXATVQYTA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|