C14H17N5O3S — CID 86689230
3-(4-aminophenyl)-5-(3-hydroxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide (PubChem CID 86689230) has the molecular formula C14H17N5O3S and a molecular weight of 335.39 g/mol. Its IUPAC name is 3-(4-aminophenyl)-5-(3-hydroxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-(4-aminophenyl)-5-(3-hydroxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 86689230 |
| Molecular Formula | C14H17N5O3S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 3-(4-aminophenyl)-5-(3-hydroxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(N)cc2)nsc1NC(=O)NCCCO |
| InChI | InChI=1S/C14H17N5O3S/c15-9-4-2-8(3-5-9)11-10(12(16)21)13(23-19-11)18-14(22)17-6-1-7-20/h2-5,20H,1,6-7,15H2,(H2,16,21)(H2,17,18,22) |
| InChIKey | TYQHNWWGKHTCBA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 143.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|