C16H17N5O6S — CID 71621784
3-[[4-carbamoyl-3-(4-nitrophenyl)-1,2-thiazol-5-yl]carbamoylamino]propyl acetate (PubChem CID 71621784) has the molecular formula C16H17N5O6S and a molecular weight of 407.41 g/mol. Its IUPAC name is 3-[[4-carbamoyl-3-(4-nitrophenyl)-1,2-thiazol-5-yl]carbamoylamino]propyl acetate.
| Compound Name | 3-[[4-carbamoyl-3-(4-nitrophenyl)-1,2-thiazol-5-yl]carbamoylamino]propyl acetate |
|---|---|
| PubChem CID | 71621784 |
| Molecular Formula | C16H17N5O6S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 3-[[4-carbamoyl-3-(4-nitrophenyl)-1,2-thiazol-5-yl]carbamoylamino]propyl acetate |
| SMILES | CC(=O)OCCCNC(=O)Nc1snc(-c2ccc([N+](=O)[O-])cc2)c1C(N)=O |
| InChI | InChI=1S/C16H17N5O6S/c1-9(22)27-8-2-7-18-16(24)19-15-12(14(17)23)13(20-28-15)10-3-5-11(6-4-10)21(25)26/h3-6H,2,7-8H2,1H3,(H2,17,23)(H2,18,19,24) |
| InChIKey | FAPBVPAUCWORHN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 166.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|