C22H28N6O9 — CID 21205277
1-(4-nitrophenyl)-3-[2-[2-[2-[2-[(4-nitrophenyl)carbamoylamino]ethoxy]ethoxy]ethoxy]ethyl]urea (PubChem CID 21205277) has the molecular formula C22H28N6O9 and a molecular weight of 520.50 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3-[2-[2-[2-[2-[(4-nitrophenyl)carbamoylamino]ethoxy]ethoxy]ethoxy]ethyl]urea.
| Compound Name | 1-(4-nitrophenyl)-3-[2-[2-[2-[2-[(4-nitrophenyl)carbamoylamino]ethoxy]ethoxy]ethoxy]ethyl]urea |
|---|---|
| PubChem CID | 21205277 |
| Molecular Formula | C22H28N6O9 |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 1-(4-nitrophenyl)-3-[2-[2-[2-[2-[(4-nitrophenyl)carbamoylamino]ethoxy]ethoxy]ethoxy]ethyl]urea |
| SMILES | O=C(NCCOCCOCCOCCNC(=O)Nc1ccc([N+](=O)[O-])cc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H28N6O9/c29-21(25-17-1-5-19(6-2-17)27(31)32)23-9-11-35-13-15-37-16-14-36-12-10-24-22(30)26-18-3-7-20(8-4-18)28(33)34/h1-8H,9-16H2,(H2,23,25,29)(H2,24,26,30) |
| InChIKey | YXEOKYFHQOTQQK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 196.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|