C11H16N4O3 — CID 43602363
1-[3-(methylamino)propyl]-3-(4-nitrophenyl)urea (PubChem CID 43602363) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1-[3-(methylamino)propyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[3-(methylamino)propyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 43602363 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-[3-(methylamino)propyl]-3-(4-nitrophenyl)urea |
| SMILES | CNCCCNC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H16N4O3/c1-12-7-2-8-13-11(16)14-9-3-5-10(6-4-9)15(17)18/h3-6,12H,2,7-8H2,1H3,(H2,13,14,16) |
| InChIKey | ZZMQPKVGSGOHCF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|