C10H14N4O5S — CID 61131418
1-(4-nitrophenyl)-3-(3-sulfamoylpropyl)urea (PubChem CID 61131418) has the molecular formula C10H14N4O5S and a molecular weight of 302.31 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3-(3-sulfamoylpropyl)urea.
| Compound Name | 1-(4-nitrophenyl)-3-(3-sulfamoylpropyl)urea |
|---|---|
| PubChem CID | 61131418 |
| Molecular Formula | C10H14N4O5S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1-(4-nitrophenyl)-3-(3-sulfamoylpropyl)urea |
| SMILES | NS(=O)(=O)CCCNC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H14N4O5S/c11-20(18,19)7-1-6-12-10(15)13-8-2-4-9(5-3-8)14(16)17/h2-5H,1,6-7H2,(H2,11,18,19)(H2,12,13,15) |
| InChIKey | LGVAHRWCUKGGFB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|