C19H25N5O2S2 — CID 54309791
3-benzylsulfanyl-5-(3-pyrrolidin-1-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxamide (PubChem CID 54309791) has the molecular formula C19H25N5O2S2 and a molecular weight of 419.58 g/mol. Its IUPAC name is 3-benzylsulfanyl-5-(3-pyrrolidin-1-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-benzylsulfanyl-5-(3-pyrrolidin-1-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 54309791 |
| Molecular Formula | C19H25N5O2S2 |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 3-benzylsulfanyl-5-(3-pyrrolidin-1-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
| SMILES | NC(=O)c1c(SCc2ccccc2)nsc1NC(=O)NCCCN1CCCC1 |
| InChI | InChI=1S/C19H25N5O2S2/c20-16(25)15-17(22-19(26)21-9-6-12-24-10-4-5-11-24)28-23-18(15)27-13-14-7-2-1-3-8-14/h1-3,7-8H,4-6,9-13H2,(H2,20,25)(H2,21,22,26) |
| InChIKey | SKBQUKSPDALSCU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|