C14H20N4O3 — CID 104743602
3-(3-pyrrolidin-1-ylpropylcarbamoylamino)pyridine-2-carboxylic acid (PubChem CID 104743602) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-(3-pyrrolidin-1-ylpropylcarbamoylamino)pyridine-2-carboxylic acid.
| Compound Name | 3-(3-pyrrolidin-1-ylpropylcarbamoylamino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 104743602 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-(3-pyrrolidin-1-ylpropylcarbamoylamino)pyridine-2-carboxylic acid |
| SMILES | O=C(NCCCN1CCCC1)Nc1cccnc1C(=O)O |
| InChI | InChI=1S/C14H20N4O3/c19-13(20)12-11(5-3-6-15-12)17-14(21)16-7-4-10-18-8-1-2-9-18/h3,5-6H,1-2,4,7-10H2,(H,19,20)(H2,16,17,21) |
| InChIKey | UEHNGBRXGZKRQI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|