C17H28N4O2 — CID 47042538
1-(2-methoxy-3-pyridinyl)-3-[4-(3-methylpiperidin-1-yl)butyl]urea (PubChem CID 47042538) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-(2-methoxy-3-pyridinyl)-3-[4-(3-methylpiperidin-1-yl)butyl]urea.
| Compound Name | 1-(2-methoxy-3-pyridinyl)-3-[4-(3-methylpiperidin-1-yl)butyl]urea |
|---|---|
| PubChem CID | 47042538 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-(2-methoxy-3-pyridinyl)-3-[4-(3-methylpiperidin-1-yl)butyl]urea |
| SMILES | COc1ncccc1NC(=O)NCCCCN1CCCC(C)C1 |
| InChI | InChI=1S/C17H28N4O2/c1-14-7-6-12-21(13-14)11-4-3-9-19-17(22)20-15-8-5-10-18-16(15)23-2/h5,8,10,14H,3-4,6-7,9,11-13H2,1-2H3,(H2,19,20,22) |
| InChIKey | UWAVSTXFAZOHCZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|