C14H24N4O — CID 56818106
N-[4-(3-methylpiperidin-1-yl)butyl]-1H-pyrazole-5-carboxamide (PubChem CID 56818106) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is N-[4-(3-methylpiperidin-1-yl)butyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-(3-methylpiperidin-1-yl)butyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 56818106 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N-[4-(3-methylpiperidin-1-yl)butyl]-1H-pyrazole-5-carboxamide |
| SMILES | CC1CCCN(CCCCNC(=O)c2ccn[nH]2)C1 |
| InChI | InChI=1S/C14H24N4O/c1-12-5-4-10-18(11-12)9-3-2-7-15-14(19)13-6-8-16-17-13/h6,8,12H,2-5,7,9-11H2,1H3,(H,15,19)(H,16,17) |
| InChIKey | AYMSNYJOTOQDTP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|