C16H25F3N4O — CID 94467076
1-methyl-N-[4-[(3R)-3-methylpiperidin-1-yl]butyl]-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 94467076) has the molecular formula C16H25F3N4O and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-methyl-N-[4-[(3R)-3-methylpiperidin-1-yl]butyl]-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[4-[(3R)-3-methylpiperidin-1-yl]butyl]-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 94467076 |
| Molecular Formula | C16H25F3N4O |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-methyl-N-[4-[(3R)-3-methylpiperidin-1-yl]butyl]-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | C[C@@H]1CCCN(CCCCNC(=O)c2cn(C)nc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H25F3N4O/c1-12-6-5-9-23(10-12)8-4-3-7-20-15(24)13-11-22(2)21-14(13)16(17,18)19/h11-12H,3-10H2,1-2H3,(H,20,24)/t12-/m1/s1 |
| InChIKey | ZLCOTAHKTFKJTK-GFCCVEGCSA-N |
| XLogP | 2.68 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|