C20H24F3N3O — CID 78885440
N-[3-(3-methylpiperidin-1-yl)propyl]-4-(trifluoromethyl)quinoline-3-carboxamide (PubChem CID 78885440) has the molecular formula C20H24F3N3O and a molecular weight of 379.43 g/mol. Its IUPAC name is N-[3-(3-methylpiperidin-1-yl)propyl]-4-(trifluoromethyl)quinoline-3-carboxamide.
| Compound Name | N-[3-(3-methylpiperidin-1-yl)propyl]-4-(trifluoromethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 78885440 |
| Molecular Formula | C20H24F3N3O |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[3-(3-methylpiperidin-1-yl)propyl]-4-(trifluoromethyl)quinoline-3-carboxamide |
| SMILES | CC1CCCN(CCCNC(=O)c2cnc3ccccc3c2C(F)(F)F)C1 |
| InChI | InChI=1S/C20H24F3N3O/c1-14-6-4-10-26(13-14)11-5-9-24-19(27)16-12-25-17-8-3-2-7-15(17)18(16)20(21,22)23/h2-3,7-8,12,14H,4-6,9-11,13H2,1H3,(H,24,27) |
| InChIKey | WSTQQXKVLJOKSK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|