C20H24N4O2S — CID 92869928
N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-4-oxo-[1,3]thiazino[3,2-a]benzimidazole-2-carboxamide (PubChem CID 92869928) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-4-oxo-[1,3]thiazino[3,2-a]benzimidazole-2-carboxamide.
| Compound Name | N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-4-oxo-[1,3]thiazino[3,2-a]benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 92869928 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-4-oxo-[1,3]thiazino[3,2-a]benzimidazole-2-carboxamide |
| SMILES | C[C@@H]1CCCN(CCCNC(=O)c2cc(=O)n3c(nc4ccccc43)s2)C1 |
| InChI | InChI=1S/C20H24N4O2S/c1-14-6-4-10-23(13-14)11-5-9-21-19(26)17-12-18(25)24-16-8-3-2-7-15(16)22-20(24)27-17/h2-3,7-8,12,14H,4-6,9-11,13H2,1H3,(H,21,26)/t14-/m1/s1 |
| InChIKey | ZRNLICKXNFSHQK-CQSZACIVSA-N |
| XLogP | 2.76 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|