C26H32N4O2 — CID 92869686
4-[(3-methyl-2-oxoquinoxalin-1-yl)methyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]benzamide (PubChem CID 92869686) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 4-[(3-methyl-2-oxoquinoxalin-1-yl)methyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]benzamide.
| Compound Name | 4-[(3-methyl-2-oxoquinoxalin-1-yl)methyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 92869686 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 4-[(3-methyl-2-oxoquinoxalin-1-yl)methyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]benzamide |
| SMILES | Cc1nc2ccccc2n(Cc2ccc(C(=O)NCCCN3CCC[C@@H](C)C3)cc2)c1=O |
| InChI | InChI=1S/C26H32N4O2/c1-19-7-5-15-29(17-19)16-6-14-27-25(31)22-12-10-21(11-13-22)18-30-24-9-4-3-8-23(24)28-20(2)26(30)32/h3-4,8-13,19H,5-7,14-18H2,1-2H3,(H,27,31)/t19-/m1/s1 |
| InChIKey | AYQCSTMKUAQYPQ-LJQANCHMSA-N |
| XLogP | 3.61 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|