C12H18F3N3O2 — CID 111460989
N-(3-hydroxy-4-methylpentyl)-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 111460989) has the molecular formula C12H18F3N3O2 and a molecular weight of 293.29 g/mol. Its IUPAC name is N-(3-hydroxy-4-methylpentyl)-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-(3-hydroxy-4-methylpentyl)-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 111460989 |
| Molecular Formula | C12H18F3N3O2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N-(3-hydroxy-4-methylpentyl)-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CC(C)C(O)CCNC(=O)c1cn(C)nc1C(F)(F)F |
| InChI | InChI=1S/C12H18F3N3O2/c1-7(2)9(19)4-5-16-11(20)8-6-18(3)17-10(8)12(13,14)15/h6-7,9,19H,4-5H2,1-3H3,(H,16,20) |
| InChIKey | KQSAUTJTNAYSEA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |