C21H19F3N4OS — CID 78901824
1-methyl-N-(3-phenothiazin-10-ylpropyl)-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 78901824) has the molecular formula C21H19F3N4OS and a molecular weight of 432.47 g/mol. Its IUPAC name is 1-methyl-N-(3-phenothiazin-10-ylpropyl)-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-(3-phenothiazin-10-ylpropyl)-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78901824 |
| Molecular Formula | C21H19F3N4OS |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1-methyl-N-(3-phenothiazin-10-ylpropyl)-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NCCCN2c3ccccc3Sc3ccccc32)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C21H19F3N4OS/c1-27-13-14(19(26-27)21(22,23)24)20(29)25-11-6-12-28-15-7-2-4-9-17(15)30-18-10-5-3-8-16(18)28/h2-5,7-10,13H,6,11-12H2,1H3,(H,25,29) |
| InChIKey | DPWAGPILXIWEAI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|