C18H22F3N3O2 — CID 87020315
N-[2-(4-tert-butylphenoxy)ethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 87020315) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 87020315 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NCCOc2ccc(C(C)(C)C)cc2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C18H22F3N3O2/c1-17(2,3)12-5-7-13(8-6-12)26-10-9-22-16(25)14-11-24(4)23-15(14)18(19,20)21/h5-8,11H,9-10H2,1-4H3,(H,22,25) |
| InChIKey | NQDZAMXNAFRRHE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|