C19H25NO3 — CID 26662426
N-[2-(4-tert-butylphenoxy)ethyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 26662426) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 26662426 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCOc2ccc(C(C)(C)C)cc2)c(C)o1 |
| InChI | InChI=1S/C19H25NO3/c1-13-12-17(14(2)23-13)18(21)20-10-11-22-16-8-6-15(7-9-16)19(3,4)5/h6-9,12H,10-11H2,1-5H3,(H,20,21) |
| InChIKey | FCXVENOCEGXXRM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|