C20H25NO4S — CID 31308822
N-[2-(4-tert-butylphenoxy)ethyl]-2-methylsulfonylbenzamide (PubChem CID 31308822) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-2-methylsulfonylbenzamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 31308822 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-methylsulfonylbenzamide |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)c2ccccc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H25NO4S/c1-20(2,3)15-9-11-16(12-10-15)25-14-13-21-19(22)17-7-5-6-8-18(17)26(4,23)24/h5-12H,13-14H2,1-4H3,(H,21,22) |
| InChIKey | RVSNAZBLDQNAEO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|