C20H25N3O3S — CID 9490188
2-(2-amino-2-oxoethyl)sulfanyl-N-[2-(4-tert-butylphenoxy)ethyl]pyridine-3-carboxamide (PubChem CID 9490188) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethyl)sulfanyl-N-[2-(4-tert-butylphenoxy)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-(2-amino-2-oxoethyl)sulfanyl-N-[2-(4-tert-butylphenoxy)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 9490188 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-(2-amino-2-oxoethyl)sulfanyl-N-[2-(4-tert-butylphenoxy)ethyl]pyridine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)c2cccnc2SCC(N)=O)cc1 |
| InChI | InChI=1S/C20H25N3O3S/c1-20(2,3)14-6-8-15(9-7-14)26-12-11-22-18(25)16-5-4-10-23-19(16)27-13-17(21)24/h4-10H,11-13H2,1-3H3,(H2,21,24)(H,22,25) |
| InChIKey | OXYQFMZCPJMHHQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|