C17H21NO3 — CID 24532323
N-[2-(4-tert-butylphenoxy)ethyl]furan-3-carboxamide (PubChem CID 24532323) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]furan-3-carboxamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 24532323 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]furan-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)c2ccoc2)cc1 |
| InChI | InChI=1S/C17H21NO3/c1-17(2,3)14-4-6-15(7-5-14)21-11-9-18-16(19)13-8-10-20-12-13/h4-8,10,12H,9,11H2,1-3H3,(H,18,19) |
| InChIKey | FQQVTXAZEFFVNJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|