C24H23N5O2 — CID 168607756
N-[2-(4-tert-butylphenoxy)ethyl]-2-(1,2,2-tricyanoethenylamino)benzamide (PubChem CID 168607756) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-2-(1,2,2-tricyanoethenylamino)benzamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-(1,2,2-tricyanoethenylamino)benzamide |
|---|---|
| PubChem CID | 168607756 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-(1,2,2-tricyanoethenylamino)benzamide |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)c2ccccc2NC(C#N)=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C24H23N5O2/c1-24(2,3)18-8-10-19(11-9-18)31-13-12-28-23(30)20-6-4-5-7-21(20)29-22(16-27)17(14-25)15-26/h4-11,29H,12-13H2,1-3H3,(H,28,30) |
| InChIKey | NLBFTEWBWHGDHV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|