C25H30N2O6 — CID 168569984
dimethyl (E)-2-[2-[2-(4-tert-butylphenoxy)ethylcarbamoyl]anilino]but-2-enedioate (PubChem CID 168569984) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is dimethyl (E)-2-[2-[2-(4-tert-butylphenoxy)ethylcarbamoyl]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-[2-(4-tert-butylphenoxy)ethylcarbamoyl]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569984 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | dimethyl (E)-2-[2-[2-(4-tert-butylphenoxy)ethylcarbamoyl]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccccc1C(=O)NCCOc1ccc(C(C)(C)C)cc1)C(=O)OC |
| InChI | InChI=1S/C25H30N2O6/c1-25(2,3)17-10-12-18(13-11-17)33-15-14-26-23(29)19-8-6-7-9-20(19)27-21(24(30)32-5)16-22(28)31-4/h6-13,16,27H,14-15H2,1-5H3,(H,26,29)/b21-16+ |
| InChIKey | YCIIFXNEGTZZIR-LTGZKZEYSA-N |
| XLogP | 3.43 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|