C21H28N2O5 — CID 168570065
dimethyl (E)-2-[2-[(4-ethylcyclohexyl)carbamoyl]anilino]but-2-enedioate (PubChem CID 168570065) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is dimethyl (E)-2-[2-[(4-ethylcyclohexyl)carbamoyl]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-[(4-ethylcyclohexyl)carbamoyl]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168570065 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | dimethyl (E)-2-[2-[(4-ethylcyclohexyl)carbamoyl]anilino]but-2-enedioate |
| SMILES | CCC1CCC(NC(=O)c2ccccc2N/C(=C/C(=O)OC)C(=O)OC)CC1 |
| InChI | InChI=1S/C21H28N2O5/c1-4-14-9-11-15(12-10-14)22-20(25)16-7-5-6-8-17(16)23-18(21(26)28-3)13-19(24)27-2/h5-8,13-15,23H,4,9-12H2,1-3H3,(H,22,25)/b18-13+ |
| InChIKey | RWXXIOYHIRGTPV-QGOAFFKASA-N |
| XLogP | 3.03 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|