C16H17NO8 — CID 168566495
dimethyl 3-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzene-1,2-dicarboxylate (PubChem CID 168566495) has the molecular formula C16H17NO8 and a molecular weight of 351.31 g/mol. Its IUPAC name is dimethyl 3-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 168566495 |
| Molecular Formula | C16H17NO8 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | dimethyl 3-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)/C=C(/Nc1cccc(C(=O)OC)c1C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H17NO8/c1-22-12(18)8-11(15(20)24-3)17-10-7-5-6-9(14(19)23-2)13(10)16(21)25-4/h5-8,17H,1-4H3/b11-8+ |
| InChIKey | KDUJDNGHGFWMNE-DHZHZOJOSA-N |
| XLogP | 0.90 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|