C17H28N2O3 — CID 60545386
3-[2-(4-tert-butylphenoxy)ethyl]-1-(2-methoxyethyl)-1-methylurea (PubChem CID 60545386) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-[2-(4-tert-butylphenoxy)ethyl]-1-(2-methoxyethyl)-1-methylurea.
| Compound Name | 3-[2-(4-tert-butylphenoxy)ethyl]-1-(2-methoxyethyl)-1-methylurea |
|---|---|
| PubChem CID | 60545386 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 3-[2-(4-tert-butylphenoxy)ethyl]-1-(2-methoxyethyl)-1-methylurea |
| SMILES | COCCN(C)C(=O)NCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H28N2O3/c1-17(2,3)14-6-8-15(9-7-14)22-12-10-18-16(20)19(4)11-13-21-5/h6-9H,10-13H2,1-5H3,(H,18,20) |
| InChIKey | NYJWABSBNYNVMT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|