C19H33NO3 — CID 5262127
3-(4-tert-butylphenoxy)-N,N-bis(2-methoxyethyl)propan-1-amine (PubChem CID 5262127) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is 3-(4-tert-butylphenoxy)-N,N-bis(2-methoxyethyl)propan-1-amine.
| Compound Name | 3-(4-tert-butylphenoxy)-N,N-bis(2-methoxyethyl)propan-1-amine |
|---|---|
| PubChem CID | 5262127 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | 3-(4-tert-butylphenoxy)-N,N-bis(2-methoxyethyl)propan-1-amine |
| SMILES | COCCN(CCCOc1ccc(C(C)(C)C)cc1)CCOC |
| InChI | InChI=1S/C19H33NO3/c1-19(2,3)17-7-9-18(10-8-17)23-14-6-11-20(12-15-21-4)13-16-22-5/h7-10H,6,11-16H2,1-5H3 |
| InChIKey | WFIWMTXBMMGCCM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|