C13H12Cl2F3N5O — CID 87020440
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 87020440) has the molecular formula C13H12Cl2F3N5O and a molecular weight of 382.17 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 87020440 |
| Molecular Formula | C13H12Cl2F3N5O |
| Molecular Weight | 382.17 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NCCNc2ncc(Cl)cc2Cl)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H12Cl2F3N5O/c1-23-6-8(10(22-23)13(16,17)18)12(24)20-3-2-19-11-9(15)4-7(14)5-21-11/h4-6H,2-3H2,1H3,(H,19,21)(H,20,24) |
| InChIKey | QLHVZCNZKMWDKH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|