C18H23Cl2N5O3S — CID 55723205
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carboxamide (PubChem CID 55723205) has the molecular formula C18H23Cl2N5O3S and a molecular weight of 460.39 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carboxamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55723205 |
| Molecular Formula | C18H23Cl2N5O3S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-methyl-4-piperidin-1-ylsulfonylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)N2CCCCC2)cc1C(=O)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C18H23Cl2N5O3S/c1-24-12-14(29(27,28)25-7-3-2-4-8-25)10-16(24)18(26)22-6-5-21-17-15(20)9-13(19)11-23-17/h9-12H,2-8H2,1H3,(H,21,23)(H,22,26) |
| InChIKey | ZHVPTNRDSBQOJY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|