C16H28N4O5S2 — CID 55955220
N-[3-[ethyl(methylsulfonyl)amino]propyl]-1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide (PubChem CID 55955220) has the molecular formula C16H28N4O5S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[3-[ethyl(methylsulfonyl)amino]propyl]-1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide.
| Compound Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55955220 |
| Molecular Formula | C16H28N4O5S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
| SMILES | CCN(CCCNC(=O)c1cc(S(=O)(=O)N2CCCC2)cn1C)S(C)(=O)=O |
| InChI | InChI=1S/C16H28N4O5S2/c1-4-19(26(3,22)23)11-7-8-17-16(21)15-12-14(13-18(15)2)27(24,25)20-9-5-6-10-20/h12-13H,4-11H2,1-3H3,(H,17,21) |
| InChIKey | OWZLNUQFHYHGPZ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|