C20H27N3O3S — CID 51266579
1-methyl-N-(2-phenylbutyl)-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide (PubChem CID 51266579) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-methyl-N-(2-phenylbutyl)-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-(2-phenylbutyl)-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 51266579 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 1-methyl-N-(2-phenylbutyl)-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxamide |
| SMILES | CCC(CNC(=O)c1cc(S(=O)(=O)N2CCCC2)cn1C)c1ccccc1 |
| InChI | InChI=1S/C20H27N3O3S/c1-3-16(17-9-5-4-6-10-17)14-21-20(24)19-13-18(15-22(19)2)27(25,26)23-11-7-8-12-23/h4-6,9-10,13,15-16H,3,7-8,11-12,14H2,1-2H3,(H,21,24) |
| InChIKey | LOPNGACYQJDUMF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |