C15H13Cl2F3N4O2 — CID 55723423
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 55723423) has the molecular formula C15H13Cl2F3N4O2 and a molecular weight of 409.20 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 55723423 |
| Molecular Formula | C15H13Cl2F3N4O2 |
| Molecular Weight | 409.20 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | O=C(Cn1cc(C(F)(F)F)ccc1=O)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2F3N4O2/c16-10-5-11(17)14(23-6-10)22-4-3-21-12(25)8-24-7-9(15(18,19)20)1-2-13(24)26/h1-2,5-7H,3-4,8H2,(H,21,25)(H,22,23) |
| InChIKey | ZTCAOQKSZSHIKX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|