C17H17F3N4O6S — CID 24504795
N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 24504795) has the molecular formula C17H17F3N4O6S and a molecular weight of 462.41 g/mol. Its IUPAC name is N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 24504795 |
| Molecular Formula | C17H17F3N4O6S |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)Cn2cc(C(F)(F)F)ccc2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17F3N4O6S/c1-31(29,30)12-3-4-13(14(8-12)24(27)28)21-6-7-22-15(25)10-23-9-11(17(18,19)20)2-5-16(23)26/h2-5,8-9,21H,6-7,10H2,1H3,(H,22,25) |
| InChIKey | XIIBSJYMKMOAFV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 140.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|