C19H19N5O9S — CID 24504835
N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 24504835) has the molecular formula C19H19N5O9S and a molecular weight of 493.45 g/mol. Its IUPAC name is N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 24504835 |
| Molecular Formula | C19H19N5O9S |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)CN2C(=O)COc3ccc([N+](=O)[O-])cc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N5O9S/c1-34(31,32)13-3-4-14(15(9-13)24(29)30)20-6-7-21-18(25)10-22-16-8-12(23(27)28)2-5-17(16)33-11-19(22)26/h2-5,8-9,20H,6-7,10-11H2,1H3,(H,21,25) |
| InChIKey | JCOCZBWEGOGNQG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 191.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|