C17H23N5O7S — CID 55699692
2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]acetamide (PubChem CID 55699692) has the molecular formula C17H23N5O7S and a molecular weight of 441.47 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]acetamide.
| Compound Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 55699692 |
| Molecular Formula | C17H23N5O7S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]acetamide |
| SMILES | CCN1CCN(CC(=O)NCCNc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])C(=O)C1=O |
| InChI | InChI=1S/C17H23N5O7S/c1-3-20-8-9-21(17(25)16(20)24)11-15(23)19-7-6-18-13-5-4-12(30(2,28)29)10-14(13)22(26)27/h4-5,10,18H,3,6-9,11H2,1-2H3,(H,19,23) |
| InChIKey | VDCKJBZVMZICJG-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|